About butyl 4-oxohex-5-enoate
butyl 4-oxohex-5-enoate (PubChem CID 87865945) has the molecular formula C10H16O3
and a molecular weight of 184.23 g/mol. Its IUPAC name is butyl 4-oxohex-5-enoate.
Molecular Properties
| Compound Name | butyl 4-oxohex-5-enoate |
| PubChem CID | 87865945 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | butyl 4-oxohex-5-enoate |
| SMILES | C=CC(=O)CCC(=O)OCCCC |
| InChI | InChI=1S/C10H16O3/c1-3-5-8-13-10(12)7-6-9(11)4-2/h4H,2-3,5-8H2,1H3 |
| InChIKey | UZTKCQQWRCYAOO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze butyl 4-oxohex-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 4-oxohex-5-enoate?
The IUPAC name of butyl 4-oxohex-5-enoate (CID 87865945) is butyl 4-oxohex-5-enoate.
What is the SMILES notation for butyl 4-oxohex-5-enoate?
The canonical SMILES for butyl 4-oxohex-5-enoate is C=CC(=O)CCC(=O)OCCCC.
What is the InChIKey of butyl 4-oxohex-5-enoate?
The InChIKey is UZTKCQQWRCYAOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3/c1-3-5-8-13-10(12)7-6-9(11)4-2/h4H,2-3,5-8H2,1H3.
What are the key properties of butyl 4-oxohex-5-enoate?
butyl 4-oxohex-5-enoate has a molecular weight of 184.23 g/mol, XLogP of 1.87, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 4-oxohex-5-enoate is sourced from PubChem (CID 87865945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).