About CID 87866538
CID 87866538 (PubChem CID 87866538) has the molecular formula C43H42Cl2SiZr
and a molecular weight of 749.03 g/mol.
Molecular Properties
| Compound Name | CID 87866538 |
| PubChem CID | 87866538 |
| Molecular Formula | C43H42Cl2SiZr |
| Molecular Weight | 749.03 g/mol |
| Exact Mass | 746.15 |
| IUPAC Name | — |
| SMILES | CC(C)c1cc(-c2c(C(C)(C)C)ccc3[cH-]c(-c4ccccc4)cc23)cc(C(C)C)c1.Cl[Zr+2]Cl.[c-]1cccc2c1[Si]c1ccccc1-2 |
| InChI | InChI=1S/C31H35.C12H7Si.2ClH.Zr/c1-20(2)24-16-25(21(3)4)18-27(17-24)30-28-19-26(22-11-9-8-10-12-22)15-23(28)13-14-29(30)31(5,6)7;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;;;/h8-21H,1-7H3;1-7H;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | WYNAYQYIMOBMBT-UHFFFAOYSA-L |
| XLogP | 11.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 749.03 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87866538 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87866538?
The IUPAC name of CID 87866538 (CID 87866538) is not available.
What is the SMILES notation for CID 87866538?
The canonical SMILES for CID 87866538 is CC(C)c1cc(-c2c(C(C)(C)C)ccc3[cH-]c(-c4ccccc4)cc23)cc(C(C)C)c1.Cl[Zr+2]Cl.[c-]1cccc2c1[Si]c1ccccc1-2.
What is the InChIKey of CID 87866538?
The InChIKey is WYNAYQYIMOBMBT-UHFFFAOYSA-L. The full InChI is InChI=1S/C31H35.C12H7Si.2ClH.Zr/c1-20(2)24-16-25(21(3)4)18-27(17-24)30-28-19-26(22-11-9-8-10-12-22)15-23(28)13-14-29(30)31(5,6)7;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;;;/h8-21H,1-7H3;1-7H;2*1H;/q2*-1;;;+4/p-2.
What are the key properties of CID 87866538?
CID 87866538 has a molecular weight of 749.03 g/mol, XLogP of 11.94, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87866538 is sourced from PubChem (CID 87866538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).