About CID 87866614
CID 87866614 (PubChem CID 87866614) has the molecular formula C32H28Cl2SiZr
and a molecular weight of 602.79 g/mol.
Molecular Properties
| Compound Name | CID 87866614 |
| PubChem CID | 87866614 |
| Molecular Formula | C32H28Cl2SiZr |
| Molecular Weight | 602.79 g/mol |
| Exact Mass | 600.04 |
| IUPAC Name | — |
| SMILES | CCc1cc2c(-c3ccccc3CC)c(C)ccc2[cH-]1.Cl[Zr+2]Cl.[c-]1cccc2c1[Si]c1ccccc1-2 |
| InChI | InChI=1S/C20H21.C12H7Si.2ClH.Zr/c1-4-15-12-17-11-10-14(3)20(19(17)13-15)18-9-7-6-8-16(18)5-2;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;;;/h6-13H,4-5H2,1-3H3;1-7H;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | JANITFVEBCXUMB-UHFFFAOYSA-L |
| XLogP | 8.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 602.79 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87866614 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87866614?
The IUPAC name of CID 87866614 (CID 87866614) is not available.
What is the SMILES notation for CID 87866614?
The canonical SMILES for CID 87866614 is CCc1cc2c(-c3ccccc3CC)c(C)ccc2[cH-]1.Cl[Zr+2]Cl.[c-]1cccc2c1[Si]c1ccccc1-2.
What is the InChIKey of CID 87866614?
The InChIKey is JANITFVEBCXUMB-UHFFFAOYSA-L. The full InChI is InChI=1S/C20H21.C12H7Si.2ClH.Zr/c1-4-15-12-17-11-10-14(3)20(19(17)13-15)18-9-7-6-8-16(18)5-2;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;;;/h6-13H,4-5H2,1-3H3;1-7H;2*1H;/q2*-1;;;+4/p-2.
What are the key properties of CID 87866614?
CID 87866614 has a molecular weight of 602.79 g/mol, XLogP of 8.16, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87866614 is sourced from PubChem (CID 87866614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).