About 1-chloro-2-[2-(1-chloro-9H-fluoren-2-yl)ethyl]-9H-fluorene;titanium
1-chloro-2-[2-(1-chloro-9H-fluoren-2-yl)ethyl]-9H-fluorene;titanium (PubChem CID 87867259) has the molecular formula C28H20Cl2Ti
and a molecular weight of 475.24 g/mol. Its IUPAC name is 1-chloro-2-[2-(1-chloro-9H-fluoren-2-yl)ethyl]-9H-fluorene;titanium.
Molecular Properties
| Compound Name | 1-chloro-2-[2-(1-chloro-9H-fluoren-2-yl)ethyl]-9H-fluorene;titanium |
| PubChem CID | 87867259 |
| Molecular Formula | C28H20Cl2Ti |
| Molecular Weight | 475.24 g/mol |
| Exact Mass | 474.04 |
| IUPAC Name | 1-chloro-2-[2-(1-chloro-9H-fluoren-2-yl)ethyl]-9H-fluorene;titanium |
| SMILES | Clc1c(CCc2ccc3c(c2Cl)Cc2ccccc2-3)ccc2c1Cc1ccccc1-2.[Ti] |
| InChI | InChI=1S/C28H20Cl2.Ti/c29-27-17(11-13-23-21-7-3-1-5-19(21)15-25(23)27)9-10-18-12-14-24-22-8-4-2-6-20(22)16-26(24)28(18)30;/h1-8,11-14H,9-10,15-16H2; |
| InChIKey | BKDCUJFMCJKUNT-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.24 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-chloro-2-[2-(1-chloro-9H-fluoren-2-yl)ethyl]-9H-fluorene;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-[2-(1-chloro-9H-fluoren-2-yl)ethyl]-9H-fluorene;titanium?
The IUPAC name of 1-chloro-2-[2-(1-chloro-9H-fluoren-2-yl)ethyl]-9H-fluorene;titanium (CID 87867259) is 1-chloro-2-[2-(1-chloro-9H-fluoren-2-yl)ethyl]-9H-fluorene;titanium.
What is the SMILES notation for 1-chloro-2-[2-(1-chloro-9H-fluoren-2-yl)ethyl]-9H-fluorene;titanium?
The canonical SMILES for 1-chloro-2-[2-(1-chloro-9H-fluoren-2-yl)ethyl]-9H-fluorene;titanium is Clc1c(CCc2ccc3c(c2Cl)Cc2ccccc2-3)ccc2c1Cc1ccccc1-2.[Ti].
What is the InChIKey of 1-chloro-2-[2-(1-chloro-9H-fluoren-2-yl)ethyl]-9H-fluorene;titanium?
The InChIKey is BKDCUJFMCJKUNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H20Cl2.Ti/c29-27-17(11-13-23-21-7-3-1-5-19(21)15-25(23)27)9-10-18-12-14-24-22-8-4-2-6-20(22)16-26(24)28(18)30;/h1-8,11-14H,9-10,15-16H2;.
What are the key properties of 1-chloro-2-[2-(1-chloro-9H-fluoren-2-yl)ethyl]-9H-fluorene;titanium?
1-chloro-2-[2-(1-chloro-9H-fluoren-2-yl)ethyl]-9H-fluorene;titanium has a molecular weight of 475.24 g/mol, XLogP of 7.92, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-[2-(1-chloro-9H-fluoren-2-yl)ethyl]-9H-fluorene;titanium is sourced from PubChem (CID 87867259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).