C13H16N2O4 — CID 87867655
3-[methoxy(methyl)carbamoyl]-3,4-dihydro-1H-isoquinoline-2-carboxylic acid (PubChem CID 87867655) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 3-[methoxy(methyl)carbamoyl]-3,4-dihydro-1H-isoquinoline-2-carboxylic acid.
| Compound Name | 3-[methoxy(methyl)carbamoyl]-3,4-dihydro-1H-isoquinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 87867655 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 3-[methoxy(methyl)carbamoyl]-3,4-dihydro-1H-isoquinoline-2-carboxylic acid |
| SMILES | CON(C)C(=O)C1Cc2ccccc2CN1C(=O)O |
| InChI | InChI=1S/C13H16N2O4/c1-14(19-2)12(16)11-7-9-5-3-4-6-10(9)8-15(11)13(17)18/h3-6,11H,7-8H2,1-2H3,(H,17,18) |
| InChIKey | GAVJREIXORFMSY-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|