C35H45OSiTi — CID 87867864
benzhydrylidenetitanium(1+);3-[tert-butyl(dimethyl)silyl]-5-methylphenol;1,2,3,5-tetramethylcyclopenta-1,3-diene (PubChem CID 87867864) has the molecular formula C35H45OSiTi and a molecular weight of 557.70 g/mol. Its IUPAC name is benzhydrylidenetitanium(1+);3-[tert-butyl(dimethyl)silyl]-5-methylphenol;1,2,3,5-tetramethylcyclopenta-1,3-diene.
| Compound Name | benzhydrylidenetitanium(1+);3-[tert-butyl(dimethyl)silyl]-5-methylphenol;1,2,3,5-tetramethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 87867864 |
| Molecular Formula | C35H45OSiTi |
| Molecular Weight | 557.70 g/mol |
| Exact Mass | 557.27 |
| IUPAC Name | benzhydrylidenetitanium(1+);3-[tert-butyl(dimethyl)silyl]-5-methylphenol;1,2,3,5-tetramethylcyclopenta-1,3-diene |
| SMILES | CC1=[C-]C(C)C(C)=C1C.Cc1cc(O)cc([Si](C)(C)C(C)(C)C)c1.[Ti+]=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H22OSi.C13H10.C9H13.Ti/c1-10-7-11(14)9-12(8-10)15(5,6)13(2,3)4;1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;1-6-5-7(2)9(4)8(6)3;/h7-9,14H,1-6H3;1-10H;6H,1-4H3;/q;;-1;+1 |
| InChIKey | XJBJHQJYPLZMJF-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.70 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|