C27H31F3N4O — CID 87867917
(5S,7R)-4-amino-8-benzyl-6-(2,3-difluorocyclohexyl)-1-(3-fluorophenyl)-7-methyl-1,3,8-triazaspiro[4.5]dec-3-en-2-one (PubChem CID 87867917) has the molecular formula C27H31F3N4O and a molecular weight of 484.57 g/mol. Its IUPAC name is (5S,7R)-4-amino-8-benzyl-6-(2,3-difluorocyclohexyl)-1-(3-fluorophenyl)-7-methyl-1,3,8-triazaspiro[4.5]dec-3-en-2-one.
| Compound Name | (5S,7R)-4-amino-8-benzyl-6-(2,3-difluorocyclohexyl)-1-(3-fluorophenyl)-7-methyl-1,3,8-triazaspiro[4.5]dec-3-en-2-one |
|---|---|
| PubChem CID | 87867917 |
| Molecular Formula | C27H31F3N4O |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | (5S,7R)-4-amino-8-benzyl-6-(2,3-difluorocyclohexyl)-1-(3-fluorophenyl)-7-methyl-1,3,8-triazaspiro[4.5]dec-3-en-2-one |
| SMILES | C[C@@H]1C(C2CCCC(F)C2F)[C@@]2(CCN1Cc1ccccc1)C(N)=NC(=O)N2c1cccc(F)c1 |
| InChI | InChI=1S/C27H31F3N4O/c1-17-23(21-11-6-12-22(29)24(21)30)27(13-14-33(17)16-18-7-3-2-4-8-18)25(31)32-26(35)34(27)20-10-5-9-19(28)15-20/h2-5,7-10,15,17,21-24H,6,11-14,16H2,1H3,(H2,31,32,35)/t17-,21?,22?,23?,24?,27+/m1/s1 |
| InChIKey | YWQUTDBFKLYKET-SPRMHOFFSA-N |
| XLogP | 5.25 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |