C25H31N3O2SSi — CID 87867975
[(1Z)-1-[tert-butyl(dimethyl)silyl]oxyimino-2,3-dihydroinden-5-yl]-[2-(ethylamino)thieno[2,3-c]pyridin-3-yl]methanone (PubChem CID 87867975) has the molecular formula C25H31N3O2SSi and a molecular weight of 465.70 g/mol. Its IUPAC name is [(1Z)-1-[tert-butyl(dimethyl)silyl]oxyimino-2,3-dihydroinden-5-yl]-[2-(ethylamino)thieno[2,3-c]pyridin-3-yl]methanone.
| Compound Name | [(1Z)-1-[tert-butyl(dimethyl)silyl]oxyimino-2,3-dihydroinden-5-yl]-[2-(ethylamino)thieno[2,3-c]pyridin-3-yl]methanone |
|---|---|
| PubChem CID | 87867975 |
| Molecular Formula | C25H31N3O2SSi |
| Molecular Weight | 465.70 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | [(1Z)-1-[tert-butyl(dimethyl)silyl]oxyimino-2,3-dihydroinden-5-yl]-[2-(ethylamino)thieno[2,3-c]pyridin-3-yl]methanone |
| SMILES | CCNc1sc2cnccc2c1C(=O)c1ccc2c(c1)CC/C2=N/O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H31N3O2SSi/c1-7-27-24-22(19-12-13-26-15-21(19)31-24)23(29)17-8-10-18-16(14-17)9-11-20(18)28-30-32(5,6)25(2,3)4/h8,10,12-15,27H,7,9,11H2,1-6H3/b28-20- |
| InChIKey | WERVUMISZCKPER-RRAHZORUSA-N |
| XLogP | 6.63 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.70 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|