C12H21N3O4 — CID 87867990
N-hydroxy-5-[2-oxo-2-[[(3R)-oxolan-3-yl]amino]ethyl]piperidine-3-carboxamide (PubChem CID 87867990) has the molecular formula C12H21N3O4 and a molecular weight of 271.32 g/mol. Its IUPAC name is N-hydroxy-5-[2-oxo-2-[[(3R)-oxolan-3-yl]amino]ethyl]piperidine-3-carboxamide.
| Compound Name | N-hydroxy-5-[2-oxo-2-[[(3R)-oxolan-3-yl]amino]ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 87867990 |
| Molecular Formula | C12H21N3O4 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | N-hydroxy-5-[2-oxo-2-[[(3R)-oxolan-3-yl]amino]ethyl]piperidine-3-carboxamide |
| SMILES | O=C(CC1CNCC(C(=O)NO)C1)N[C@@H]1CCOC1 |
| InChI | InChI=1S/C12H21N3O4/c16-11(14-10-1-2-19-7-10)4-8-3-9(6-13-5-8)12(17)15-18/h8-10,13,18H,1-7H2,(H,14,16)(H,15,17)/t8?,9?,10-/m1/s1 |
| InChIKey | KYCVECMVRPDUCB-UDNWOFFPSA-N |
| XLogP | -0.99 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|