C14H12F3NO8 — CID 87868002
azane;(2S)-3-(5,7-dihydroxy-2-oxochromen-4-yl)-2-(2,2,2-trifluoroacetyl)oxypropanoic acid (PubChem CID 87868002) has the molecular formula C14H12F3NO8 and a molecular weight of 379.24 g/mol. Its IUPAC name is azane;(2S)-3-(5,7-dihydroxy-2-oxochromen-4-yl)-2-(2,2,2-trifluoroacetyl)oxypropanoic acid.
| Compound Name | azane;(2S)-3-(5,7-dihydroxy-2-oxochromen-4-yl)-2-(2,2,2-trifluoroacetyl)oxypropanoic acid |
|---|---|
| PubChem CID | 87868002 |
| Molecular Formula | C14H12F3NO8 |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | azane;(2S)-3-(5,7-dihydroxy-2-oxochromen-4-yl)-2-(2,2,2-trifluoroacetyl)oxypropanoic acid |
| SMILES | N.O=C(O)[C@H](Cc1cc(=O)oc2cc(O)cc(O)c12)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C14H9F3O8.H3N/c15-14(16,17)13(23)25-9(12(21)22)1-5-2-10(20)24-8-4-6(18)3-7(19)11(5)8;/h2-4,9,18-19H,1H2,(H,21,22);1H3/t9-;/m0./s1 |
| InChIKey | KSTCRIIDWJELNJ-FVGYRXGTSA-N |
| XLogP | 1.47 |
| TPSA | 169.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|