C25H33N5O5 — CID 87868022
(2S,3S,5S)-2-[4-(4-cyano-2-methylphenyl)-1,2,3,6-tetrahydropyridine-2-carbonyl]-N-hydroxy-5-[2-(2-methoxyethylamino)-2-oxoethyl]piperidine-3-carboxamide (PubChem CID 87868022) has the molecular formula C25H33N5O5 and a molecular weight of 483.57 g/mol. Its IUPAC name is (2S,3S,5S)-2-[4-(4-cyano-2-methylphenyl)-1,2,3,6-tetrahydropyridine-2-carbonyl]-N-hydroxy-5-[2-(2-methoxyethylamino)-2-oxoethyl]piperidine-3-carboxamide.
| Compound Name | (2S,3S,5S)-2-[4-(4-cyano-2-methylphenyl)-1,2,3,6-tetrahydropyridine-2-carbonyl]-N-hydroxy-5-[2-(2-methoxyethylamino)-2-oxoethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 87868022 |
| Molecular Formula | C25H33N5O5 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | (2S,3S,5S)-2-[4-(4-cyano-2-methylphenyl)-1,2,3,6-tetrahydropyridine-2-carbonyl]-N-hydroxy-5-[2-(2-methoxyethylamino)-2-oxoethyl]piperidine-3-carboxamide |
| SMILES | COCCNC(=O)C[C@H]1CN[C@H](C(=O)C2CC(c3ccc(C#N)cc3C)=CCN2)[C@@H](C(=O)NO)C1 |
| InChI | InChI=1S/C25H33N5O5/c1-15-9-16(13-26)3-4-19(15)18-5-6-27-21(12-18)24(32)23-20(25(33)30-34)10-17(14-29-23)11-22(31)28-7-8-35-2/h3-5,9,17,20-21,23,27,29,34H,6-8,10-12,14H2,1-2H3,(H,28,31)(H,30,33)/t17-,20-,21?,23-/m0/s1 |
| InChIKey | MYMZPXQMACSWAE-CDXKHQTHSA-N |
| XLogP | 0.43 |
| TPSA | 152.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|