About 2H-pyrido[3,2-b][1,4]oxazine-6-carbaldehyde
2H-pyrido[3,2-b][1,4]oxazine-6-carbaldehyde (PubChem CID 87868996) has the molecular formula C8H6N2O2
and a molecular weight of 162.15 g/mol. Its IUPAC name is 2H-pyrido[3,2-b][1,4]oxazine-6-carbaldehyde.
Molecular Properties
| Compound Name | 2H-pyrido[3,2-b][1,4]oxazine-6-carbaldehyde |
| PubChem CID | 87868996 |
| Molecular Formula | C8H6N2O2 |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | 2H-pyrido[3,2-b][1,4]oxazine-6-carbaldehyde |
| SMILES | O=Cc1ccc2c(n1)N=CCO2 |
| InChI | InChI=1S/C8H6N2O2/c11-5-6-1-2-7-8(10-6)9-3-4-12-7/h1-3,5H,4H2 |
| InChIKey | KBUKVNCANNQFCI-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2H-pyrido[3,2-b][1,4]oxazine-6-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-pyrido[3,2-b][1,4]oxazine-6-carbaldehyde?
The IUPAC name of 2H-pyrido[3,2-b][1,4]oxazine-6-carbaldehyde (CID 87868996) is 2H-pyrido[3,2-b][1,4]oxazine-6-carbaldehyde.
What is the SMILES notation for 2H-pyrido[3,2-b][1,4]oxazine-6-carbaldehyde?
The canonical SMILES for 2H-pyrido[3,2-b][1,4]oxazine-6-carbaldehyde is O=Cc1ccc2c(n1)N=CCO2.
What is the InChIKey of 2H-pyrido[3,2-b][1,4]oxazine-6-carbaldehyde?
The InChIKey is KBUKVNCANNQFCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2/c11-5-6-1-2-7-8(10-6)9-3-4-12-7/h1-3,5H,4H2.
What are the key properties of 2H-pyrido[3,2-b][1,4]oxazine-6-carbaldehyde?
2H-pyrido[3,2-b][1,4]oxazine-6-carbaldehyde has a molecular weight of 162.15 g/mol, XLogP of 0.99, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-pyrido[3,2-b][1,4]oxazine-6-carbaldehyde is sourced from PubChem (CID 87868996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).