About bis[(2S)-3,3-dimethyl-1-[3-(trifluoromethyl)pyrazol-1-yl]butan-2-yl] carbonate
bis[(2S)-3,3-dimethyl-1-[3-(trifluoromethyl)pyrazol-1-yl]butan-2-yl] carbonate (PubChem CID 87869267) has the molecular formula C21H28F6N4O3
and a molecular weight of 498.47 g/mol. Its IUPAC name is bis[(2S)-3,3-dimethyl-1-[3-(trifluoromethyl)pyrazol-1-yl]butan-2-yl] carbonate.
Molecular Properties
| Compound Name | bis[(2S)-3,3-dimethyl-1-[3-(trifluoromethyl)pyrazol-1-yl]butan-2-yl] carbonate |
| PubChem CID | 87869267 |
| Molecular Formula | C21H28F6N4O3 |
| Molecular Weight | 498.47 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | bis[(2S)-3,3-dimethyl-1-[3-(trifluoromethyl)pyrazol-1-yl]butan-2-yl] carbonate |
| SMILES | CC(C)(C)[C@@H](Cn1ccc(C(F)(F)F)n1)OC(=O)O[C@H](Cn1ccc(C(F)(F)F)n1)C(C)(C)C |
| InChI | InChI=1S/C21H28F6N4O3/c1-18(2,3)15(11-30-9-7-13(28-30)20(22,23)24)33-17(32)34-16(19(4,5)6)12-31-10-8-14(29-31)21(25,26)27/h7-10,15-16H,11-12H2,1-6H3/t15-,16-/m1/s1 |
| InChIKey | SSYVQQOBVOOPKR-HZPDHXFCSA-N |
| XLogP | 5.80 |
| TPSA | 71.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 498.47 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze bis[(2S)-3,3-dimethyl-1-[3-(trifluoromethyl)pyrazol-1-yl]butan-2-yl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[(2S)-3,3-dimethyl-1-[3-(trifluoromethyl)pyrazol-1-yl]butan-2-yl] carbonate?
The IUPAC name of bis[(2S)-3,3-dimethyl-1-[3-(trifluoromethyl)pyrazol-1-yl]butan-2-yl] carbonate (CID 87869267) is bis[(2S)-3,3-dimethyl-1-[3-(trifluoromethyl)pyrazol-1-yl]butan-2-yl] carbonate.
What is the SMILES notation for bis[(2S)-3,3-dimethyl-1-[3-(trifluoromethyl)pyrazol-1-yl]butan-2-yl] carbonate?
The canonical SMILES for bis[(2S)-3,3-dimethyl-1-[3-(trifluoromethyl)pyrazol-1-yl]butan-2-yl] carbonate is CC(C)(C)[C@@H](Cn1ccc(C(F)(F)F)n1)OC(=O)O[C@H](Cn1ccc(C(F)(F)F)n1)C(C)(C)C.
What is the InChIKey of bis[(2S)-3,3-dimethyl-1-[3-(trifluoromethyl)pyrazol-1-yl]butan-2-yl] carbonate?
The InChIKey is SSYVQQOBVOOPKR-HZPDHXFCSA-N. The full InChI is InChI=1S/C21H28F6N4O3/c1-18(2,3)15(11-30-9-7-13(28-30)20(22,23)24)33-17(32)34-16(19(4,5)6)12-31-10-8-14(29-31)21(25,26)27/h7-10,15-16H,11-12H2,1-6H3/t15-,16-/m1/s1.
What are the key properties of bis[(2S)-3,3-dimethyl-1-[3-(trifluoromethyl)pyrazol-1-yl]butan-2-yl] carbonate?
bis[(2S)-3,3-dimethyl-1-[3-(trifluoromethyl)pyrazol-1-yl]butan-2-yl] carbonate has a molecular weight of 498.47 g/mol, XLogP of 5.80, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis[(2S)-3,3-dimethyl-1-[3-(trifluoromethyl)pyrazol-1-yl]butan-2-yl] carbonate is sourced from PubChem (CID 87869267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).