C24H23F6N7O — CID 87869773
8-[(3R)-oxolan-3-yl]-7-[3-(trifluoromethyl)-2-pyridinyl]-4-N-[5-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine (PubChem CID 87869773) has the molecular formula C24H23F6N7O and a molecular weight of 539.48 g/mol. Its IUPAC name is 8-[(3R)-oxolan-3-yl]-7-[3-(trifluoromethyl)-2-pyridinyl]-4-N-[5-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine.
| Compound Name | 8-[(3R)-oxolan-3-yl]-7-[3-(trifluoromethyl)-2-pyridinyl]-4-N-[5-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine |
|---|---|
| PubChem CID | 87869773 |
| Molecular Formula | C24H23F6N7O |
| Molecular Weight | 539.48 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | 8-[(3R)-oxolan-3-yl]-7-[3-(trifluoromethyl)-2-pyridinyl]-4-N-[5-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine |
| SMILES | Nc1nc2c(c(Nc3ccc(C(F)(F)F)cn3)n1)CCN(c1ncccc1C(F)(F)F)C([C@H]1CCOC1)C2 |
| InChI | InChI=1S/C24H23F6N7O/c25-23(26,27)14-3-4-19(33-11-14)35-20-15-5-8-37(21-16(24(28,29)30)2-1-7-32-21)18(13-6-9-38-12-13)10-17(15)34-22(31)36-20/h1-4,7,11,13,18H,5-6,8-10,12H2,(H3,31,33,34,35,36)/t13-,18?/m0/s1 |
| InChIKey | NEZMETSYLXEKEA-FVRDMJKUSA-N |
| XLogP | 4.64 |
| TPSA | 102.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.48 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |