About 3-methoxy-1-methyl-1-(1,2-thiazol-5-yl)urea
3-methoxy-1-methyl-1-(1,2-thiazol-5-yl)urea (PubChem CID 87869781) has the molecular formula C6H9N3O2S
and a molecular weight of 187.22 g/mol. Its IUPAC name is 3-methoxy-1-methyl-1-(1,2-thiazol-5-yl)urea.
Molecular Properties
| Compound Name | 3-methoxy-1-methyl-1-(1,2-thiazol-5-yl)urea |
| PubChem CID | 87869781 |
| Molecular Formula | C6H9N3O2S |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 3-methoxy-1-methyl-1-(1,2-thiazol-5-yl)urea |
| SMILES | CONC(=O)N(C)c1ccns1 |
| InChI | InChI=1S/C6H9N3O2S/c1-9(6(10)8-11-2)5-3-4-7-12-5/h3-4H,1-2H3,(H,8,10) |
| InChIKey | LWTMLISBCHFGSJ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxy-1-methyl-1-(1,2-thiazol-5-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-1-methyl-1-(1,2-thiazol-5-yl)urea?
The IUPAC name of 3-methoxy-1-methyl-1-(1,2-thiazol-5-yl)urea (CID 87869781) is 3-methoxy-1-methyl-1-(1,2-thiazol-5-yl)urea.
What is the SMILES notation for 3-methoxy-1-methyl-1-(1,2-thiazol-5-yl)urea?
The canonical SMILES for 3-methoxy-1-methyl-1-(1,2-thiazol-5-yl)urea is CONC(=O)N(C)c1ccns1.
What is the InChIKey of 3-methoxy-1-methyl-1-(1,2-thiazol-5-yl)urea?
The InChIKey is LWTMLISBCHFGSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O2S/c1-9(6(10)8-11-2)5-3-4-7-12-5/h3-4H,1-2H3,(H,8,10).
What are the key properties of 3-methoxy-1-methyl-1-(1,2-thiazol-5-yl)urea?
3-methoxy-1-methyl-1-(1,2-thiazol-5-yl)urea has a molecular weight of 187.22 g/mol, XLogP of 0.85, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-1-methyl-1-(1,2-thiazol-5-yl)urea is sourced from PubChem (CID 87869781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).