C15H19N3O4 — CID 87869789
4-[(E)-N'-(2-phenylacetyl)oxycarbamimidoyl]piperidine-1-carboxylic acid (PubChem CID 87869789) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is 4-[(E)-N'-(2-phenylacetyl)oxycarbamimidoyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[(E)-N'-(2-phenylacetyl)oxycarbamimidoyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 87869789 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 4-[(E)-N'-(2-phenylacetyl)oxycarbamimidoyl]piperidine-1-carboxylic acid |
| SMILES | N/C(=N/OC(=O)Cc1ccccc1)C1CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C15H19N3O4/c16-14(12-6-8-18(9-7-12)15(20)21)17-22-13(19)10-11-4-2-1-3-5-11/h1-5,12H,6-10H2,(H2,16,17)(H,20,21) |
| InChIKey | OSEOPHLHTLNJTF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|