C26H30F3N3O6S — CID 87869816
[2-(2,3-dihydroxypropyl)-1'-(2-phenoxyethyl)spiro[4,9-dihydro-3H-pyrido[3,4-b]indole-1,3'-pyrrolidine]-6-yl] trifluoromethanesulfonate (PubChem CID 87869816) has the molecular formula C26H30F3N3O6S and a molecular weight of 569.60 g/mol. Its IUPAC name is [2-(2,3-dihydroxypropyl)-1'-(2-phenoxyethyl)spiro[4,9-dihydro-3H-pyrido[3,4-b]indole-1,3'-pyrrolidine]-6-yl] trifluoromethanesulfonate.
| Compound Name | [2-(2,3-dihydroxypropyl)-1'-(2-phenoxyethyl)spiro[4,9-dihydro-3H-pyrido[3,4-b]indole-1,3'-pyrrolidine]-6-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87869816 |
| Molecular Formula | C26H30F3N3O6S |
| Molecular Weight | 569.60 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | [2-(2,3-dihydroxypropyl)-1'-(2-phenoxyethyl)spiro[4,9-dihydro-3H-pyrido[3,4-b]indole-1,3'-pyrrolidine]-6-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2[nH]c3c(c2c1)CCN(CC(O)CO)C31CCN(CCOc2ccccc2)C1)C(F)(F)F |
| InChI | InChI=1S/C26H30F3N3O6S/c27-26(28,29)39(35,36)38-20-6-7-23-22(14-20)21-8-10-32(15-18(34)16-33)25(24(21)30-23)9-11-31(17-25)12-13-37-19-4-2-1-3-5-19/h1-7,14,18,30,33-34H,8-13,15-17H2 |
| InChIKey | GGIUABUZHRRWDJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.60 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|