About dibromopalladium;2,4-dipropyl-4,5-dihydro-1,3-oxazole
dibromopalladium;2,4-dipropyl-4,5-dihydro-1,3-oxazole (PubChem CID 87869832) has the molecular formula C9H17Br2NOPd
and a molecular weight of 421.47 g/mol. Its IUPAC name is dibromopalladium;2,4-dipropyl-4,5-dihydro-1,3-oxazole.
Molecular Properties
| Compound Name | dibromopalladium;2,4-dipropyl-4,5-dihydro-1,3-oxazole |
| PubChem CID | 87869832 |
| Molecular Formula | C9H17Br2NOPd |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 418.87 |
| IUPAC Name | dibromopalladium;2,4-dipropyl-4,5-dihydro-1,3-oxazole |
| SMILES | Br[Pd]Br.CCCC1=NC(CCC)CO1 |
| InChI | InChI=1S/C9H17NO.2BrH.Pd/c1-3-5-8-7-11-9(10-8)6-4-2;;;/h8H,3-7H2,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | ZTZSUKYLRDCGAV-UHFFFAOYSA-L |
| XLogP | 4.07 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze dibromopalladium;2,4-dipropyl-4,5-dihydro-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibromopalladium;2,4-dipropyl-4,5-dihydro-1,3-oxazole?
The IUPAC name of dibromopalladium;2,4-dipropyl-4,5-dihydro-1,3-oxazole (CID 87869832) is dibromopalladium;2,4-dipropyl-4,5-dihydro-1,3-oxazole.
What is the SMILES notation for dibromopalladium;2,4-dipropyl-4,5-dihydro-1,3-oxazole?
The canonical SMILES for dibromopalladium;2,4-dipropyl-4,5-dihydro-1,3-oxazole is Br[Pd]Br.CCCC1=NC(CCC)CO1.
What is the InChIKey of dibromopalladium;2,4-dipropyl-4,5-dihydro-1,3-oxazole?
The InChIKey is ZTZSUKYLRDCGAV-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H17NO.2BrH.Pd/c1-3-5-8-7-11-9(10-8)6-4-2;;;/h8H,3-7H2,1-2H3;2*1H;/q;;;+2/p-2.
What are the key properties of dibromopalladium;2,4-dipropyl-4,5-dihydro-1,3-oxazole?
dibromopalladium;2,4-dipropyl-4,5-dihydro-1,3-oxazole has a molecular weight of 421.47 g/mol, XLogP of 4.07, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dibromopalladium;2,4-dipropyl-4,5-dihydro-1,3-oxazole is sourced from PubChem (CID 87869832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).