C20H20N2O2 — CID 87869917
2-[(10R,15S)-4-oxa-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-7-yl]benzaldehyde (PubChem CID 87869917) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-[(10R,15S)-4-oxa-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-7-yl]benzaldehyde.
| Compound Name | 2-[(10R,15S)-4-oxa-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-7-yl]benzaldehyde |
|---|---|
| PubChem CID | 87869917 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 2-[(10R,15S)-4-oxa-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-7-yl]benzaldehyde |
| SMILES | O=Cc1ccccc1-c1cc2c3c(c1)[C@@H]1CNCC[C@@H]1N3CCO2 |
| InChI | InChI=1S/C20H20N2O2/c23-12-13-3-1-2-4-15(13)14-9-16-17-11-21-6-5-18(17)22-7-8-24-19(10-14)20(16)22/h1-4,9-10,12,17-18,21H,5-8,11H2/t17-,18-/m0/s1 |
| InChIKey | FXMIDTOESZLMEF-ROUUACIJSA-N |
| XLogP | 2.82 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|