C22H25N5O2S — CID 87870025
2-(1H-benzimidazol-2-yl)-1-[5-[4-[3-(dimethylamino)propoxy]phenyl]-1,3,4-oxadiazol-2-yl]ethanethiol (PubChem CID 87870025) has the molecular formula C22H25N5O2S and a molecular weight of 423.54 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-1-[5-[4-[3-(dimethylamino)propoxy]phenyl]-1,3,4-oxadiazol-2-yl]ethanethiol.
| Compound Name | 2-(1H-benzimidazol-2-yl)-1-[5-[4-[3-(dimethylamino)propoxy]phenyl]-1,3,4-oxadiazol-2-yl]ethanethiol |
|---|---|
| PubChem CID | 87870025 |
| Molecular Formula | C22H25N5O2S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-1-[5-[4-[3-(dimethylamino)propoxy]phenyl]-1,3,4-oxadiazol-2-yl]ethanethiol |
| SMILES | CN(C)CCCOc1ccc(-c2nnc(C(S)Cc3nc4ccccc4[nH]3)o2)cc1 |
| InChI | InChI=1S/C22H25N5O2S/c1-27(2)12-5-13-28-16-10-8-15(9-11-16)21-25-26-22(29-21)19(30)14-20-23-17-6-3-4-7-18(17)24-20/h3-4,6-11,19,30H,5,12-14H2,1-2H3,(H,23,24) |
| InChIKey | RLXDDLBCTTVCDV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 80.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|