C21H25N5O2S — CID 87870070
(7R,7aS)-7-amino-2-[4-[1-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]cyclobutyl]phenyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione (PubChem CID 87870070) has the molecular formula C21H25N5O2S and a molecular weight of 411.53 g/mol. Its IUPAC name is (7R,7aS)-7-amino-2-[4-[1-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]cyclobutyl]phenyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione.
| Compound Name | (7R,7aS)-7-amino-2-[4-[1-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]cyclobutyl]phenyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
|---|---|
| PubChem CID | 87870070 |
| Molecular Formula | C21H25N5O2S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | (7R,7aS)-7-amino-2-[4-[1-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]cyclobutyl]phenyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
| SMILES | Cc1cnc(NCC2(c3ccc(N4C(=O)[C@@H]5[C@H](N)CCN5C4=O)cc3)CCC2)s1 |
| InChI | InChI=1S/C21H25N5O2S/c1-13-11-23-19(29-13)24-12-21(8-2-9-21)14-3-5-15(6-4-14)26-18(27)17-16(22)7-10-25(17)20(26)28/h3-6,11,16-17H,2,7-10,12,22H2,1H3,(H,23,24)/t16-,17+/m1/s1 |
| InChIKey | YFXCQGOEXCBCDQ-SJORKVTESA-N |
| XLogP | 2.85 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|