C29H38F6O4Si — CID 87870255
[(2S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenyl-2-triethylsilyloxypropyl] 2,2-dimethylpropanoate (PubChem CID 87870255) has the molecular formula C29H38F6O4Si and a molecular weight of 592.69 g/mol. Its IUPAC name is [(2S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenyl-2-triethylsilyloxypropyl] 2,2-dimethylpropanoate.
| Compound Name | [(2S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenyl-2-triethylsilyloxypropyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 87870255 |
| Molecular Formula | C29H38F6O4Si |
| Molecular Weight | 592.69 g/mol |
| Exact Mass | 592.24 |
| IUPAC Name | [(2S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenyl-2-triethylsilyloxypropyl] 2,2-dimethylpropanoate |
| SMILES | CC[Si](CC)(CC)O[C@@](COCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)(COC(=O)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C29H38F6O4Si/c1-7-40(8-2,9-3)39-27(22-13-11-10-12-14-22,20-38-25(36)26(4,5)6)19-37-18-21-15-23(28(30,31)32)17-24(16-21)29(33,34)35/h10-17H,7-9,18-20H2,1-6H3/t27-/m0/s1 |
| InChIKey | WXIYKAPCUQLLBX-MHZLTWQESA-N |
| XLogP | 8.75 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.69 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|