C20H25N5OS — CID 87870269
(7R,7aS)-7-amino-2-[4-[1-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]cyclopropyl]phenyl]-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-1-one (PubChem CID 87870269) has the molecular formula C20H25N5OS and a molecular weight of 383.52 g/mol. Its IUPAC name is (7R,7aS)-7-amino-2-[4-[1-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]cyclopropyl]phenyl]-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-1-one.
| Compound Name | (7R,7aS)-7-amino-2-[4-[1-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]cyclopropyl]phenyl]-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-1-one |
|---|---|
| PubChem CID | 87870269 |
| Molecular Formula | C20H25N5OS |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | (7R,7aS)-7-amino-2-[4-[1-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]cyclopropyl]phenyl]-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-1-one |
| SMILES | Cc1cnc(NCC2(c3ccc(N4CN5CC[C@@H](N)[C@H]5C4=O)cc3)CC2)s1 |
| InChI | InChI=1S/C20H25N5OS/c1-13-10-22-19(27-13)23-11-20(7-8-20)14-2-4-15(5-3-14)25-12-24-9-6-16(21)17(24)18(25)26/h2-5,10,16-17H,6-9,11-12,21H2,1H3,(H,22,23)/t16-,17+/m1/s1 |
| InChIKey | WCKPWSKFTWGRLC-SJORKVTESA-N |
| XLogP | 2.30 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |