About ethyl (E)-2,3,4-trifluoropent-2-enoate
ethyl (E)-2,3,4-trifluoropent-2-enoate (PubChem CID 87870484) has the molecular formula C7H9F3O2
and a molecular weight of 182.14 g/mol. Its IUPAC name is ethyl (E)-2,3,4-trifluoropent-2-enoate.
Molecular Properties
| Compound Name | ethyl (E)-2,3,4-trifluoropent-2-enoate |
| PubChem CID | 87870484 |
| Molecular Formula | C7H9F3O2 |
| Molecular Weight | 182.14 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | ethyl (E)-2,3,4-trifluoropent-2-enoate |
| SMILES | CCOC(=O)/C(F)=C(\F)C(C)F |
| InChI | InChI=1S/C7H9F3O2/c1-3-12-7(11)6(10)5(9)4(2)8/h4H,3H2,1-2H3/b6-5+ |
| InChIKey | YNRPEXBCJQSZLC-AATRIKPKSA-N |
| XLogP | 2.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.14 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-2,3,4-trifluoropent-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-2,3,4-trifluoropent-2-enoate?
The IUPAC name of ethyl (E)-2,3,4-trifluoropent-2-enoate (CID 87870484) is ethyl (E)-2,3,4-trifluoropent-2-enoate.
What is the SMILES notation for ethyl (E)-2,3,4-trifluoropent-2-enoate?
The canonical SMILES for ethyl (E)-2,3,4-trifluoropent-2-enoate is CCOC(=O)/C(F)=C(\F)C(C)F.
What is the InChIKey of ethyl (E)-2,3,4-trifluoropent-2-enoate?
The InChIKey is YNRPEXBCJQSZLC-AATRIKPKSA-N. The full InChI is InChI=1S/C7H9F3O2/c1-3-12-7(11)6(10)5(9)4(2)8/h4H,3H2,1-2H3/b6-5+.
What are the key properties of ethyl (E)-2,3,4-trifluoropent-2-enoate?
ethyl (E)-2,3,4-trifluoropent-2-enoate has a molecular weight of 182.14 g/mol, XLogP of 2.06, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-2,3,4-trifluoropent-2-enoate is sourced from PubChem (CID 87870484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).