C26H39N5O5 — CID 87870505
methyl (5S,6S)-5-(hydroxycarbamoyl)-6-(4-phenylpiperazine-1-carbonyl)-2-[(3S)-piperidin-3-yl]azocane-1-carboxylate (PubChem CID 87870505) has the molecular formula C26H39N5O5 and a molecular weight of 501.63 g/mol. Its IUPAC name is methyl (5S,6S)-5-(hydroxycarbamoyl)-6-(4-phenylpiperazine-1-carbonyl)-2-[(3S)-piperidin-3-yl]azocane-1-carboxylate.
| Compound Name | methyl (5S,6S)-5-(hydroxycarbamoyl)-6-(4-phenylpiperazine-1-carbonyl)-2-[(3S)-piperidin-3-yl]azocane-1-carboxylate |
|---|---|
| PubChem CID | 87870505 |
| Molecular Formula | C26H39N5O5 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.30 |
| IUPAC Name | methyl (5S,6S)-5-(hydroxycarbamoyl)-6-(4-phenylpiperazine-1-carbonyl)-2-[(3S)-piperidin-3-yl]azocane-1-carboxylate |
| SMILES | COC(=O)N1CC[C@H](C(=O)N2CCN(c3ccccc3)CC2)[C@@H](C(=O)NO)CCC1[C@H]1CCCNC1 |
| InChI | InChI=1S/C26H39N5O5/c1-36-26(34)31-13-11-22(21(24(32)28-35)9-10-23(31)19-6-5-12-27-18-19)25(33)30-16-14-29(15-17-30)20-7-3-2-4-8-20/h2-4,7-8,19,21-23,27,35H,5-6,9-18H2,1H3,(H,28,32)/t19-,21-,22-,23?/m0/s1 |
| InChIKey | LPJURFWQMQGHDY-CLONRYIISA-N |
| XLogP | 1.69 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|