C24H30N2O3 — CID 87870974
2-amino-4-(4-tert-butylphenoxy)-3-oxo-N-(1,2,3,4-tetrahydronaphthalen-1-yl)butanamide (PubChem CID 87870974) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is 2-amino-4-(4-tert-butylphenoxy)-3-oxo-N-(1,2,3,4-tetrahydronaphthalen-1-yl)butanamide.
| Compound Name | 2-amino-4-(4-tert-butylphenoxy)-3-oxo-N-(1,2,3,4-tetrahydronaphthalen-1-yl)butanamide |
|---|---|
| PubChem CID | 87870974 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 2-amino-4-(4-tert-butylphenoxy)-3-oxo-N-(1,2,3,4-tetrahydronaphthalen-1-yl)butanamide |
| SMILES | CC(C)(C)c1ccc(OCC(=O)C(N)C(=O)NC2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C24H30N2O3/c1-24(2,3)17-11-13-18(14-12-17)29-15-21(27)22(25)23(28)26-20-10-6-8-16-7-4-5-9-19(16)20/h4-5,7,9,11-14,20,22H,6,8,10,15,25H2,1-3H3,(H,26,28) |
| InChIKey | QAYCUXQBBSWBMK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|