C20H34N2O — CID 87871332
3-cyclohexyl-1-ethyl-1-[(5E,7E,9E)-undeca-5,7,9-trienyl]urea (PubChem CID 87871332) has the molecular formula C20H34N2O and a molecular weight of 318.50 g/mol. Its IUPAC name is 3-cyclohexyl-1-ethyl-1-[(5E,7E,9E)-undeca-5,7,9-trienyl]urea.
| Compound Name | 3-cyclohexyl-1-ethyl-1-[(5E,7E,9E)-undeca-5,7,9-trienyl]urea |
|---|---|
| PubChem CID | 87871332 |
| Molecular Formula | C20H34N2O |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.27 |
| IUPAC Name | 3-cyclohexyl-1-ethyl-1-[(5E,7E,9E)-undeca-5,7,9-trienyl]urea |
| SMILES | C/C=C/C=C/C=C/CCCCN(CC)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C20H34N2O/c1-3-5-6-7-8-9-10-11-15-18-22(4-2)20(23)21-19-16-13-12-14-17-19/h3,5-9,19H,4,10-18H2,1-2H3,(H,21,23)/b5-3+,7-6+,9-8+ |
| InChIKey | ZUFAKLKISTZBQL-HBJGMSRDSA-N |
| XLogP | 5.21 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|