About 1-cyclohexyl-1-ethyl-3-undeca-5,7,9-trienylurea
1-cyclohexyl-1-ethyl-3-undeca-5,7,9-trienylurea (PubChem CID 87871333) has the molecular formula C20H34N2O
and a molecular weight of 318.50 g/mol. Its IUPAC name is 1-cyclohexyl-1-ethyl-3-undeca-5,7,9-trienylurea.
Molecular Properties
| Compound Name | 1-cyclohexyl-1-ethyl-3-undeca-5,7,9-trienylurea |
| PubChem CID | 87871333 |
| Molecular Formula | C20H34N2O |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.27 |
| IUPAC Name | 1-cyclohexyl-1-ethyl-3-undeca-5,7,9-trienylurea |
| SMILES | CC=CC=CC=CCCCCNC(=O)N(CC)C1CCCCC1 |
| InChI | InChI=1S/C20H34N2O/c1-3-5-6-7-8-9-10-11-15-18-21-20(23)22(4-2)19-16-13-12-14-17-19/h3,5-9,19H,4,10-18H2,1-2H3,(H,21,23) |
| InChIKey | ZHAQEDUXCNYCOO-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-1-ethyl-3-undeca-5,7,9-trienylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-1-ethyl-3-undeca-5,7,9-trienylurea?
The IUPAC name of 1-cyclohexyl-1-ethyl-3-undeca-5,7,9-trienylurea (CID 87871333) is 1-cyclohexyl-1-ethyl-3-undeca-5,7,9-trienylurea.
What is the SMILES notation for 1-cyclohexyl-1-ethyl-3-undeca-5,7,9-trienylurea?
The canonical SMILES for 1-cyclohexyl-1-ethyl-3-undeca-5,7,9-trienylurea is CC=CC=CC=CCCCCNC(=O)N(CC)C1CCCCC1.
What is the InChIKey of 1-cyclohexyl-1-ethyl-3-undeca-5,7,9-trienylurea?
The InChIKey is ZHAQEDUXCNYCOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34N2O/c1-3-5-6-7-8-9-10-11-15-18-21-20(23)22(4-2)19-16-13-12-14-17-19/h3,5-9,19H,4,10-18H2,1-2H3,(H,21,23).
What are the key properties of 1-cyclohexyl-1-ethyl-3-undeca-5,7,9-trienylurea?
1-cyclohexyl-1-ethyl-3-undeca-5,7,9-trienylurea has a molecular weight of 318.50 g/mol, XLogP of 5.21, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-1-ethyl-3-undeca-5,7,9-trienylurea is sourced from PubChem (CID 87871333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).