C22H23N3O4 — CID 87871388
N-[2-[[5-[3-(hydroxyamino)-3-oxopropyl]-6-oxo-2,3-dihydropyridin-1-yl]methyl]phenyl]benzamide (PubChem CID 87871388) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is N-[2-[[5-[3-(hydroxyamino)-3-oxopropyl]-6-oxo-2,3-dihydropyridin-1-yl]methyl]phenyl]benzamide.
| Compound Name | N-[2-[[5-[3-(hydroxyamino)-3-oxopropyl]-6-oxo-2,3-dihydropyridin-1-yl]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 87871388 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-[2-[[5-[3-(hydroxyamino)-3-oxopropyl]-6-oxo-2,3-dihydropyridin-1-yl]methyl]phenyl]benzamide |
| SMILES | O=C(CCC1=CCCN(Cc2ccccc2NC(=O)c2ccccc2)C1=O)NO |
| InChI | InChI=1S/C22H23N3O4/c26-20(24-29)13-12-17-10-6-14-25(22(17)28)15-18-9-4-5-11-19(18)23-21(27)16-7-2-1-3-8-16/h1-5,7-11,29H,6,12-15H2,(H,23,27)(H,24,26) |
| InChIKey | CDJCECQZHHBAGN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|