About methyl 3-methyl-3-(4-nitroimidazol-1-yl)butanoate;5-nitro-1H-imidazole
methyl 3-methyl-3-(4-nitroimidazol-1-yl)butanoate;5-nitro-1H-imidazole (PubChem CID 87872377) has the molecular formula C12H16N6O6
and a molecular weight of 340.30 g/mol. Its IUPAC name is methyl 3-methyl-3-(4-nitroimidazol-1-yl)butanoate;5-nitro-1H-imidazole.
Molecular Properties
| Compound Name | methyl 3-methyl-3-(4-nitroimidazol-1-yl)butanoate;5-nitro-1H-imidazole |
| PubChem CID | 87872377 |
| Molecular Formula | C12H16N6O6 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | methyl 3-methyl-3-(4-nitroimidazol-1-yl)butanoate;5-nitro-1H-imidazole |
| SMILES | COC(=O)CC(C)(C)n1cnc([N+](=O)[O-])c1.O=[N+]([O-])c1cnc[nH]1 |
| InChI | InChI=1S/C9H13N3O4.C3H3N3O2/c1-9(2,4-8(13)16-3)11-5-7(10-6-11)12(14)15;7-6(8)3-1-4-2-5-3/h5-6H,4H2,1-3H3;1-2H,(H,4,5) |
| InChIKey | NPKPWQNBWNAQNR-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 159.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-methyl-3-(4-nitroimidazol-1-yl)butanoate;5-nitro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-methyl-3-(4-nitroimidazol-1-yl)butanoate;5-nitro-1H-imidazole?
The IUPAC name of methyl 3-methyl-3-(4-nitroimidazol-1-yl)butanoate;5-nitro-1H-imidazole (CID 87872377) is methyl 3-methyl-3-(4-nitroimidazol-1-yl)butanoate;5-nitro-1H-imidazole.
What is the SMILES notation for methyl 3-methyl-3-(4-nitroimidazol-1-yl)butanoate;5-nitro-1H-imidazole?
The canonical SMILES for methyl 3-methyl-3-(4-nitroimidazol-1-yl)butanoate;5-nitro-1H-imidazole is COC(=O)CC(C)(C)n1cnc([N+](=O)[O-])c1.O=[N+]([O-])c1cnc[nH]1.
What is the InChIKey of methyl 3-methyl-3-(4-nitroimidazol-1-yl)butanoate;5-nitro-1H-imidazole?
The InChIKey is NPKPWQNBWNAQNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O4.C3H3N3O2/c1-9(2,4-8(13)16-3)11-5-7(10-6-11)12(14)15;7-6(8)3-1-4-2-5-3/h5-6H,4H2,1-3H3;1-2H,(H,4,5).
What are the key properties of methyl 3-methyl-3-(4-nitroimidazol-1-yl)butanoate;5-nitro-1H-imidazole?
methyl 3-methyl-3-(4-nitroimidazol-1-yl)butanoate;5-nitro-1H-imidazole has a molecular weight of 340.30 g/mol, XLogP of 1.41, 5 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-methyl-3-(4-nitroimidazol-1-yl)butanoate;5-nitro-1H-imidazole is sourced from PubChem (CID 87872377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).