C22H44O21P4 — CID 87872454
[2-hydroxy-6-[hydroxy(propanoyloxymethoxy)phosphoryl]oxy-2-octyl-3,4,5-triphosphonooxycyclohexyl] butanoate (PubChem CID 87872454) has the molecular formula C22H44O21P4 and a molecular weight of 768.47 g/mol. Its IUPAC name is [2-hydroxy-6-[hydroxy(propanoyloxymethoxy)phosphoryl]oxy-2-octyl-3,4,5-triphosphonooxycyclohexyl] butanoate.
| Compound Name | [2-hydroxy-6-[hydroxy(propanoyloxymethoxy)phosphoryl]oxy-2-octyl-3,4,5-triphosphonooxycyclohexyl] butanoate |
|---|---|
| PubChem CID | 87872454 |
| Molecular Formula | C22H44O21P4 |
| Molecular Weight | 768.47 g/mol |
| Exact Mass | 768.13 |
| IUPAC Name | [2-hydroxy-6-[hydroxy(propanoyloxymethoxy)phosphoryl]oxy-2-octyl-3,4,5-triphosphonooxycyclohexyl] butanoate |
| SMILES | CCCCCCCCC1(O)C(OC(=O)CCC)C(OP(=O)(O)OCOC(=O)CC)C(OP(=O)(O)O)C(OP(=O)(O)O)C1OP(=O)(O)O |
| InChI | InChI=1S/C22H44O21P4/c1-4-7-8-9-10-11-13-22(25)20(39-16(24)12-5-2)18(42-47(35,36)38-14-37-15(23)6-3)17(40-44(26,27)28)19(41-45(29,30)31)21(22)43-46(32,33)34/h17-21,25H,4-14H2,1-3H3,(H,35,36)(H2,26,27,28)(H2,29,30,31)(H2,32,33,34) |
| InChIKey | BMGCKOXNSIIAGI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 328.87 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.47 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|