About 2-oxoethyl 6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate
2-oxoethyl 6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate (PubChem CID 87872478) has the molecular formula C11H12O5
and a molecular weight of 224.21 g/mol. Its IUPAC name is 2-oxoethyl 6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | 2-oxoethyl 6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate |
| PubChem CID | 87872478 |
| Molecular Formula | C11H12O5 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 2-oxoethyl 6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate |
| SMILES | CC(=O)C1(O)C=CC=CC1C(=O)OCC=O |
| InChI | InChI=1S/C11H12O5/c1-8(13)11(15)5-3-2-4-9(11)10(14)16-7-6-12/h2-6,9,15H,7H2,1H3 |
| InChIKey | PCDSDCIDAMVWIY-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-oxoethyl 6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxoethyl 6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate?
The IUPAC name of 2-oxoethyl 6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate (CID 87872478) is 2-oxoethyl 6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate.
What is the SMILES notation for 2-oxoethyl 6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate?
The canonical SMILES for 2-oxoethyl 6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate is CC(=O)C1(O)C=CC=CC1C(=O)OCC=O.
What is the InChIKey of 2-oxoethyl 6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate?
The InChIKey is PCDSDCIDAMVWIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O5/c1-8(13)11(15)5-3-2-4-9(11)10(14)16-7-6-12/h2-6,9,15H,7H2,1H3.
What are the key properties of 2-oxoethyl 6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate?
2-oxoethyl 6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate has a molecular weight of 224.21 g/mol, XLogP of -0.21, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxoethyl 6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate is sourced from PubChem (CID 87872478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).