C36H78OSi2 — CID 87872800
tert-butyl-[tert-butyl-(3-tert-butyl-2,2,4,4-tetramethylpentan-3-yl)-methylsilyl]oxy-(3-tert-butyl-2,2,4,4-tetramethylpentan-3-yl)-methylsilane (PubChem CID 87872800) has the molecular formula C36H78OSi2 and a molecular weight of 583.19 g/mol. Its IUPAC name is tert-butyl-[tert-butyl-(3-tert-butyl-2,2,4,4-tetramethylpentan-3-yl)-methylsilyl]oxy-(3-tert-butyl-2,2,4,4-tetramethylpentan-3-yl)-methylsilane.
| Compound Name | tert-butyl-[tert-butyl-(3-tert-butyl-2,2,4,4-tetramethylpentan-3-yl)-methylsilyl]oxy-(3-tert-butyl-2,2,4,4-tetramethylpentan-3-yl)-methylsilane |
|---|---|
| PubChem CID | 87872800 |
| Molecular Formula | C36H78OSi2 |
| Molecular Weight | 583.19 g/mol |
| Exact Mass | 582.56 |
| IUPAC Name | tert-butyl-[tert-butyl-(3-tert-butyl-2,2,4,4-tetramethylpentan-3-yl)-methylsilyl]oxy-(3-tert-butyl-2,2,4,4-tetramethylpentan-3-yl)-methylsilane |
| SMILES | CC(C)(C)C(C(C)(C)C)(C(C)(C)C)[Si](C)(O[Si](C)(C(C)(C)C)C(C(C)(C)C)(C(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C36H78OSi2/c1-27(2,3)35(28(4,5)6,29(7,8)9)38(25,33(19,20)21)37-39(26,34(22,23)24)36(30(10,11)12,31(13,14)15)32(16,17)18/h1-26H3 |
| InChIKey | PCIRFSSYCIZXOB-UHFFFAOYSA-N |
| XLogP | 13.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.19 |
| LogP ≤ 5 | 13.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|