About 3-methylidene-4-pentyl-2-phenyl-1,3-oxazolidin-3-ium-5-one
3-methylidene-4-pentyl-2-phenyl-1,3-oxazolidin-3-ium-5-one (PubChem CID 87872883) has the molecular formula C15H20NO2+
and a molecular weight of 246.33 g/mol. Its IUPAC name is 3-methylidene-4-pentyl-2-phenyl-1,3-oxazolidin-3-ium-5-one.
Molecular Properties
| Compound Name | 3-methylidene-4-pentyl-2-phenyl-1,3-oxazolidin-3-ium-5-one |
| PubChem CID | 87872883 |
| Molecular Formula | C15H20NO2+ |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 3-methylidene-4-pentyl-2-phenyl-1,3-oxazolidin-3-ium-5-one |
| SMILES | C=[N+]1C(CCCCC)C(=O)OC1c1ccccc1 |
| InChI | InChI=1S/C15H20NO2/c1-3-4-6-11-13-15(17)18-14(16(13)2)12-9-7-5-8-10-12/h5,7-10,13-14H,2-4,6,11H2,1H3/q+1 |
| InChIKey | XMHOZLNGMCVEPM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methylidene-4-pentyl-2-phenyl-1,3-oxazolidin-3-ium-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylidene-4-pentyl-2-phenyl-1,3-oxazolidin-3-ium-5-one?
The IUPAC name of 3-methylidene-4-pentyl-2-phenyl-1,3-oxazolidin-3-ium-5-one (CID 87872883) is 3-methylidene-4-pentyl-2-phenyl-1,3-oxazolidin-3-ium-5-one.
What is the SMILES notation for 3-methylidene-4-pentyl-2-phenyl-1,3-oxazolidin-3-ium-5-one?
The canonical SMILES for 3-methylidene-4-pentyl-2-phenyl-1,3-oxazolidin-3-ium-5-one is C=[N+]1C(CCCCC)C(=O)OC1c1ccccc1.
What is the InChIKey of 3-methylidene-4-pentyl-2-phenyl-1,3-oxazolidin-3-ium-5-one?
The InChIKey is XMHOZLNGMCVEPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20NO2/c1-3-4-6-11-13-15(17)18-14(16(13)2)12-9-7-5-8-10-12/h5,7-10,13-14H,2-4,6,11H2,1H3/q+1.
What are the key properties of 3-methylidene-4-pentyl-2-phenyl-1,3-oxazolidin-3-ium-5-one?
3-methylidene-4-pentyl-2-phenyl-1,3-oxazolidin-3-ium-5-one has a molecular weight of 246.33 g/mol, XLogP of 2.90, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylidene-4-pentyl-2-phenyl-1,3-oxazolidin-3-ium-5-one is sourced from PubChem (CID 87872883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).