About hydron;oxo-bis(prop-2-enoxy)azanium
hydron;oxo-bis(prop-2-enoxy)azanium (PubChem CID 87873196) has the molecular formula C6H11NO3+2
and a molecular weight of 145.16 g/mol. Its IUPAC name is hydron;oxo-bis(prop-2-enoxy)azanium.
Molecular Properties
| Compound Name | hydron;oxo-bis(prop-2-enoxy)azanium |
| PubChem CID | 87873196 |
| Molecular Formula | C6H11NO3+2 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | hydron;oxo-bis(prop-2-enoxy)azanium |
| SMILES | C=CCO[N+](=O)OCC=C.[H+] |
| InChI | InChI=1S/C6H10NO3/c1-3-5-9-7(8)10-6-4-2/h3-4H,1-2,5-6H2/q+1/p+1 |
| InChIKey | LPSDZBNNUYGOIP-UHFFFAOYSA-O |
| XLogP | 1.11 |
| TPSA | 38.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydron;oxo-bis(prop-2-enoxy)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;oxo-bis(prop-2-enoxy)azanium?
The IUPAC name of hydron;oxo-bis(prop-2-enoxy)azanium (CID 87873196) is hydron;oxo-bis(prop-2-enoxy)azanium.
What is the SMILES notation for hydron;oxo-bis(prop-2-enoxy)azanium?
The canonical SMILES for hydron;oxo-bis(prop-2-enoxy)azanium is C=CCO[N+](=O)OCC=C.[H+].
What is the InChIKey of hydron;oxo-bis(prop-2-enoxy)azanium?
The InChIKey is LPSDZBNNUYGOIP-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H10NO3/c1-3-5-9-7(8)10-6-4-2/h3-4H,1-2,5-6H2/q+1/p+1.
What are the key properties of hydron;oxo-bis(prop-2-enoxy)azanium?
hydron;oxo-bis(prop-2-enoxy)azanium has a molecular weight of 145.16 g/mol, XLogP of 1.11, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;oxo-bis(prop-2-enoxy)azanium is sourced from PubChem (CID 87873196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).