C17H16AsCl2FN2O3 — CID 87873503
CID 87873503 (PubChem CID 87873503) has the molecular formula C17H16AsCl2FN2O3 and a molecular weight of 461.15 g/mol.
| Compound Name | CID 87873503 |
|---|---|
| PubChem CID | 87873503 |
| Molecular Formula | C17H16AsCl2FN2O3 |
| Molecular Weight | 461.15 g/mol |
| Exact Mass | 459.97 |
| IUPAC Name | — |
| SMILES | Cl.O=C(O)c1cn(C2CC2)c2c(Cl)c(N3CCC([As])C3)c(F)cc2c1=O |
| InChI | InChI=1S/C17H15AsClFN2O3.ClH/c18-8-3-4-21(6-8)15-12(20)5-10-14(13(15)19)22(9-1-2-9)7-11(16(10)23)17(24)25;/h5,7-9H,1-4,6H2,(H,24,25);1H |
| InChIKey | MJVCRWRGJWNFLU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.15 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|