C21H27ClF3N5O — CID 87873625
2-[4-[[6-[ethyl(methyl)amino]-2-methylpyrimidin-4-yl]amino]cyclohexyl]-3,4,5-trifluorobenzamide;hydrochloride (PubChem CID 87873625) has the molecular formula C21H27ClF3N5O and a molecular weight of 457.93 g/mol. Its IUPAC name is 2-[4-[[6-[ethyl(methyl)amino]-2-methylpyrimidin-4-yl]amino]cyclohexyl]-3,4,5-trifluorobenzamide;hydrochloride.
| Compound Name | 2-[4-[[6-[ethyl(methyl)amino]-2-methylpyrimidin-4-yl]amino]cyclohexyl]-3,4,5-trifluorobenzamide;hydrochloride |
|---|---|
| PubChem CID | 87873625 |
| Molecular Formula | C21H27ClF3N5O |
| Molecular Weight | 457.93 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 2-[4-[[6-[ethyl(methyl)amino]-2-methylpyrimidin-4-yl]amino]cyclohexyl]-3,4,5-trifluorobenzamide;hydrochloride |
| SMILES | CCN(C)c1cc(NC2CCC(c3c(C(N)=O)cc(F)c(F)c3F)CC2)nc(C)n1.Cl |
| InChI | InChI=1S/C21H26F3N5O.ClH/c1-4-29(3)17-10-16(26-11(2)27-17)28-13-7-5-12(6-8-13)18-14(21(25)30)9-15(22)19(23)20(18)24;/h9-10,12-13H,4-8H2,1-3H3,(H2,25,30)(H,26,27,28);1H |
| InChIKey | ZQVWJDWYOPWSKY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.93 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|