C18H38O19P4 — CID 87873694
[(1S,2S,3S,4R,5S,6R)-2-hydroxy-2-octyl-3,4,5,6-tetraphosphonooxycyclohexyl] butanoate (PubChem CID 87873694) has the molecular formula C18H38O19P4 and a molecular weight of 682.38 g/mol. Its IUPAC name is [(1S,2S,3S,4R,5S,6R)-2-hydroxy-2-octyl-3,4,5,6-tetraphosphonooxycyclohexyl] butanoate.
| Compound Name | [(1S,2S,3S,4R,5S,6R)-2-hydroxy-2-octyl-3,4,5,6-tetraphosphonooxycyclohexyl] butanoate |
|---|---|
| PubChem CID | 87873694 |
| Molecular Formula | C18H38O19P4 |
| Molecular Weight | 682.38 g/mol |
| Exact Mass | 682.10 |
| IUPAC Name | [(1S,2S,3S,4R,5S,6R)-2-hydroxy-2-octyl-3,4,5,6-tetraphosphonooxycyclohexyl] butanoate |
| SMILES | CCCCCCCC[C@@]1(O)[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O)O)[C@@H]1OC(=O)CCC |
| InChI | InChI=1S/C18H38O19P4/c1-3-5-6-7-8-9-11-18(20)16(33-12(19)10-4-2)14(35-39(24,25)26)13(34-38(21,22)23)15(36-40(27,28)29)17(18)37-41(30,31)32/h13-17,20H,3-11H2,1-2H3,(H2,21,22,23)(H2,24,25,26)(H2,27,28,29)(H2,30,31,32)/t13-,14-,15+,16-,17-,18-/m0/s1 |
| InChIKey | ZKZBUEAEXDXQCC-PCCRXHMLSA-N |
| XLogP | 1.11 |
| TPSA | 313.57 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.38 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|