About [3-[2-[carbamimidoyl-(methylideneamino)amino]ethoxy]-5-methylphenyl] 3-methylbenzenesulfonate;nitric acid
[3-[2-[carbamimidoyl-(methylideneamino)amino]ethoxy]-5-methylphenyl] 3-methylbenzenesulfonate;nitric acid (PubChem CID 87874073) has the molecular formula C18H23N5O7S
and a molecular weight of 453.48 g/mol. Its IUPAC name is [3-[2-[carbamimidoyl-(methylideneamino)amino]ethoxy]-5-methylphenyl] 3-methylbenzenesulfonate;nitric acid.
Molecular Properties
| Compound Name | [3-[2-[carbamimidoyl-(methylideneamino)amino]ethoxy]-5-methylphenyl] 3-methylbenzenesulfonate;nitric acid |
| PubChem CID | 87874073 |
| Molecular Formula | C18H23N5O7S |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | [3-[2-[carbamimidoyl-(methylideneamino)amino]ethoxy]-5-methylphenyl] 3-methylbenzenesulfonate;nitric acid |
| SMILES | O=[N+]([O-])O.[H]/N=C(\N)N(CCOc1cc(C)cc(OS(=O)(=O)c2cccc(C)c2)c1)N=C |
| InChI | InChI=1S/C18H22N4O4S.HNO3/c1-13-5-4-6-17(11-13)27(23,24)26-16-10-14(2)9-15(12-16)25-8-7-22(21-3)18(19)20;2-1(3)4/h4-6,9-12H,3,7-8H2,1-2H3,(H3,19,20);(H,2,3,4) |
| InChIKey | SBYSZQDAPLHXSO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 181.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [3-[2-[carbamimidoyl-(methylideneamino)amino]ethoxy]-5-methylphenyl] 3-methylbenzenesulfonate;nitric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[2-[carbamimidoyl-(methylideneamino)amino]ethoxy]-5-methylphenyl] 3-methylbenzenesulfonate;nitric acid?
The IUPAC name of [3-[2-[carbamimidoyl-(methylideneamino)amino]ethoxy]-5-methylphenyl] 3-methylbenzenesulfonate;nitric acid (CID 87874073) is [3-[2-[carbamimidoyl-(methylideneamino)amino]ethoxy]-5-methylphenyl] 3-methylbenzenesulfonate;nitric acid.
What is the SMILES notation for [3-[2-[carbamimidoyl-(methylideneamino)amino]ethoxy]-5-methylphenyl] 3-methylbenzenesulfonate;nitric acid?
The canonical SMILES for [3-[2-[carbamimidoyl-(methylideneamino)amino]ethoxy]-5-methylphenyl] 3-methylbenzenesulfonate;nitric acid is O=[N+]([O-])O.[H]/N=C(\N)N(CCOc1cc(C)cc(OS(=O)(=O)c2cccc(C)c2)c1)N=C.
What is the InChIKey of [3-[2-[carbamimidoyl-(methylideneamino)amino]ethoxy]-5-methylphenyl] 3-methylbenzenesulfonate;nitric acid?
The InChIKey is SBYSZQDAPLHXSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N4O4S.HNO3/c1-13-5-4-6-17(11-13)27(23,24)26-16-10-14(2)9-15(12-16)25-8-7-22(21-3)18(19)20;2-1(3)4/h4-6,9-12H,3,7-8H2,1-2H3,(H3,19,20);(H,2,3,4).
What are the key properties of [3-[2-[carbamimidoyl-(methylideneamino)amino]ethoxy]-5-methylphenyl] 3-methylbenzenesulfonate;nitric acid?
[3-[2-[carbamimidoyl-(methylideneamino)amino]ethoxy]-5-methylphenyl] 3-methylbenzenesulfonate;nitric acid has a molecular weight of 453.48 g/mol, XLogP of 1.91, 8 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[2-[carbamimidoyl-(methylideneamino)amino]ethoxy]-5-methylphenyl] 3-methylbenzenesulfonate;nitric acid is sourced from PubChem (CID 87874073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).