About di(butan-2-yl)-chloro-(2,3-dimethylbutan-2-yl)silane
di(butan-2-yl)-chloro-(2,3-dimethylbutan-2-yl)silane (PubChem CID 87874164) has the molecular formula C14H31ClSi
and a molecular weight of 262.94 g/mol. Its IUPAC name is di(butan-2-yl)-chloro-(2,3-dimethylbutan-2-yl)silane.
Molecular Properties
| Compound Name | di(butan-2-yl)-chloro-(2,3-dimethylbutan-2-yl)silane |
| PubChem CID | 87874164 |
| Molecular Formula | C14H31ClSi |
| Molecular Weight | 262.94 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | di(butan-2-yl)-chloro-(2,3-dimethylbutan-2-yl)silane |
| SMILES | CCC(C)[Si](Cl)(C(C)CC)C(C)(C)C(C)C |
| InChI | InChI=1S/C14H31ClSi/c1-9-12(5)16(15,13(6)10-2)14(7,8)11(3)4/h11-13H,9-10H2,1-8H3 |
| InChIKey | NAEUKIWHBKSJTB-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 262.94 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze di(butan-2-yl)-chloro-(2,3-dimethylbutan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(butan-2-yl)-chloro-(2,3-dimethylbutan-2-yl)silane?
The IUPAC name of di(butan-2-yl)-chloro-(2,3-dimethylbutan-2-yl)silane (CID 87874164) is di(butan-2-yl)-chloro-(2,3-dimethylbutan-2-yl)silane.
What is the SMILES notation for di(butan-2-yl)-chloro-(2,3-dimethylbutan-2-yl)silane?
The canonical SMILES for di(butan-2-yl)-chloro-(2,3-dimethylbutan-2-yl)silane is CCC(C)[Si](Cl)(C(C)CC)C(C)(C)C(C)C.
What is the InChIKey of di(butan-2-yl)-chloro-(2,3-dimethylbutan-2-yl)silane?
The InChIKey is NAEUKIWHBKSJTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31ClSi/c1-9-12(5)16(15,13(6)10-2)14(7,8)11(3)4/h11-13H,9-10H2,1-8H3.
What are the key properties of di(butan-2-yl)-chloro-(2,3-dimethylbutan-2-yl)silane?
di(butan-2-yl)-chloro-(2,3-dimethylbutan-2-yl)silane has a molecular weight of 262.94 g/mol, XLogP of 6.21, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for di(butan-2-yl)-chloro-(2,3-dimethylbutan-2-yl)silane is sourced from PubChem (CID 87874164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).