About [3-[(3Z)-3-(diaminomethylidenehydrazinylidene)propoxy]-5-methylphenyl] pyridine-3-sulfonate
[3-[(3Z)-3-(diaminomethylidenehydrazinylidene)propoxy]-5-methylphenyl] pyridine-3-sulfonate (PubChem CID 87874202) has the molecular formula C16H19N5O4S
and a molecular weight of 377.43 g/mol. Its IUPAC name is [3-[(3Z)-3-(diaminomethylidenehydrazinylidene)propoxy]-5-methylphenyl] pyridine-3-sulfonate.
Molecular Properties
| Compound Name | [3-[(3Z)-3-(diaminomethylidenehydrazinylidene)propoxy]-5-methylphenyl] pyridine-3-sulfonate |
| PubChem CID | 87874202 |
| Molecular Formula | C16H19N5O4S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | [3-[(3Z)-3-(diaminomethylidenehydrazinylidene)propoxy]-5-methylphenyl] pyridine-3-sulfonate |
| SMILES | Cc1cc(OCC/C=N\N=C(N)N)cc(OS(=O)(=O)c2cccnc2)c1 |
| InChI | InChI=1S/C16H19N5O4S/c1-12-8-13(24-7-3-6-20-21-16(17)18)10-14(9-12)25-26(22,23)15-4-2-5-19-11-15/h2,4-6,8-11H,3,7H2,1H3,(H4,17,18,21)/b20-6- |
| InChIKey | QREUPLNJQSRSCO-IOXNKQMXSA-N |
| XLogP | 1.19 |
| TPSA | 142.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [3-[(3Z)-3-(diaminomethylidenehydrazinylidene)propoxy]-5-methylphenyl] pyridine-3-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(3Z)-3-(diaminomethylidenehydrazinylidene)propoxy]-5-methylphenyl] pyridine-3-sulfonate?
The IUPAC name of [3-[(3Z)-3-(diaminomethylidenehydrazinylidene)propoxy]-5-methylphenyl] pyridine-3-sulfonate (CID 87874202) is [3-[(3Z)-3-(diaminomethylidenehydrazinylidene)propoxy]-5-methylphenyl] pyridine-3-sulfonate.
What is the SMILES notation for [3-[(3Z)-3-(diaminomethylidenehydrazinylidene)propoxy]-5-methylphenyl] pyridine-3-sulfonate?
The canonical SMILES for [3-[(3Z)-3-(diaminomethylidenehydrazinylidene)propoxy]-5-methylphenyl] pyridine-3-sulfonate is Cc1cc(OCC/C=N\N=C(N)N)cc(OS(=O)(=O)c2cccnc2)c1.
What is the InChIKey of [3-[(3Z)-3-(diaminomethylidenehydrazinylidene)propoxy]-5-methylphenyl] pyridine-3-sulfonate?
The InChIKey is QREUPLNJQSRSCO-IOXNKQMXSA-N. The full InChI is InChI=1S/C16H19N5O4S/c1-12-8-13(24-7-3-6-20-21-16(17)18)10-14(9-12)25-26(22,23)15-4-2-5-19-11-15/h2,4-6,8-11H,3,7H2,1H3,(H4,17,18,21)/b20-6-.
What are the key properties of [3-[(3Z)-3-(diaminomethylidenehydrazinylidene)propoxy]-5-methylphenyl] pyridine-3-sulfonate?
[3-[(3Z)-3-(diaminomethylidenehydrazinylidene)propoxy]-5-methylphenyl] pyridine-3-sulfonate has a molecular weight of 377.43 g/mol, XLogP of 1.19, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(3Z)-3-(diaminomethylidenehydrazinylidene)propoxy]-5-methylphenyl] pyridine-3-sulfonate is sourced from PubChem (CID 87874202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).