About bis(2-bromobenzenediazonium);fluoro(dioxido)borane
bis(2-bromobenzenediazonium);fluoro(dioxido)borane (PubChem CID 87874286) has the molecular formula C12H8BBr2FN4O2
and a molecular weight of 429.84 g/mol. Its IUPAC name is bis(2-bromobenzenediazonium);fluoro(dioxido)borane.
Molecular Properties
| Compound Name | bis(2-bromobenzenediazonium);fluoro(dioxido)borane |
| PubChem CID | 87874286 |
| Molecular Formula | C12H8BBr2FN4O2 |
| Molecular Weight | 429.84 g/mol |
| Exact Mass | 427.91 |
| IUPAC Name | bis(2-bromobenzenediazonium);fluoro(dioxido)borane |
| SMILES | N#[N+]c1ccccc1Br.N#[N+]c1ccccc1Br.[O-]B([O-])F |
| InChI | InChI=1S/2C6H4BrN2.BFO2/c2*7-5-3-1-2-4-6(5)9-8;2-1(3)4/h2*1-4H;/q2*+1;-2 |
| InChIKey | TXZGBDJAEYUARW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.84 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(2-bromobenzenediazonium);fluoro(dioxido)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-bromobenzenediazonium);fluoro(dioxido)borane?
The IUPAC name of bis(2-bromobenzenediazonium);fluoro(dioxido)borane (CID 87874286) is bis(2-bromobenzenediazonium);fluoro(dioxido)borane.
What is the SMILES notation for bis(2-bromobenzenediazonium);fluoro(dioxido)borane?
The canonical SMILES for bis(2-bromobenzenediazonium);fluoro(dioxido)borane is N#[N+]c1ccccc1Br.N#[N+]c1ccccc1Br.[O-]B([O-])F.
What is the InChIKey of bis(2-bromobenzenediazonium);fluoro(dioxido)borane?
The InChIKey is TXZGBDJAEYUARW-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H4BrN2.BFO2/c2*7-5-3-1-2-4-6(5)9-8;2-1(3)4/h2*1-4H;/q2*+1;-2.
What are the key properties of bis(2-bromobenzenediazonium);fluoro(dioxido)borane?
bis(2-bromobenzenediazonium);fluoro(dioxido)borane has a molecular weight of 429.84 g/mol, XLogP of 3.53, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-bromobenzenediazonium);fluoro(dioxido)borane is sourced from PubChem (CID 87874286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).