C26H36N2Ni — CID 87874872
5-N-(3,4-dimethylphenyl)-6-N-(3,5-dimethylphenyl)decane-5,6-diimine;nickel (PubChem CID 87874872) has the molecular formula C26H36N2Ni and a molecular weight of 435.28 g/mol. Its IUPAC name is 5-N-(3,4-dimethylphenyl)-6-N-(3,5-dimethylphenyl)decane-5,6-diimine;nickel.
| Compound Name | 5-N-(3,4-dimethylphenyl)-6-N-(3,5-dimethylphenyl)decane-5,6-diimine;nickel |
|---|---|
| PubChem CID | 87874872 |
| Molecular Formula | C26H36N2Ni |
| Molecular Weight | 435.28 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 5-N-(3,4-dimethylphenyl)-6-N-(3,5-dimethylphenyl)decane-5,6-diimine;nickel |
| SMILES | CCCCC(=N\c1cc(C)cc(C)c1)/C(CCCC)=N/c1ccc(C)c(C)c1.[Ni] |
| InChI | InChI=1S/C26H36N2.Ni/c1-7-9-11-25(27-23-14-13-21(5)22(6)18-23)26(12-10-8-2)28-24-16-19(3)15-20(4)17-24;/h13-18H,7-12H2,1-6H3;/b27-25+,28-26+; |
| InChIKey | GLEOABIGIGPNIQ-GKSBCSGRSA-N |
| XLogP | 8.14 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.28 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|