About 1-[3-hydroxy-3-(2-sulfanylpropan-2-ylsulfanyl)propyl]sulfanyl-5,5-dimethylhexan-2-ol
1-[3-hydroxy-3-(2-sulfanylpropan-2-ylsulfanyl)propyl]sulfanyl-5,5-dimethylhexan-2-ol (PubChem CID 87875026) has the molecular formula C14H30O2S3
and a molecular weight of 326.59 g/mol. Its IUPAC name is 1-[3-hydroxy-3-(2-sulfanylpropan-2-ylsulfanyl)propyl]sulfanyl-5,5-dimethylhexan-2-ol.
Molecular Properties
| Compound Name | 1-[3-hydroxy-3-(2-sulfanylpropan-2-ylsulfanyl)propyl]sulfanyl-5,5-dimethylhexan-2-ol |
| PubChem CID | 87875026 |
| Molecular Formula | C14H30O2S3 |
| Molecular Weight | 326.59 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 1-[3-hydroxy-3-(2-sulfanylpropan-2-ylsulfanyl)propyl]sulfanyl-5,5-dimethylhexan-2-ol |
| SMILES | CC(C)(C)CCC(O)CSCCC(O)SC(C)(C)S |
| InChI | InChI=1S/C14H30O2S3/c1-13(2,3)8-6-11(15)10-18-9-7-12(16)19-14(4,5)17/h11-12,15-17H,6-10H2,1-5H3 |
| InChIKey | UMGRZOFSYSQLND-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.59 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-hydroxy-3-(2-sulfanylpropan-2-ylsulfanyl)propyl]sulfanyl-5,5-dimethylhexan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-hydroxy-3-(2-sulfanylpropan-2-ylsulfanyl)propyl]sulfanyl-5,5-dimethylhexan-2-ol?
The IUPAC name of 1-[3-hydroxy-3-(2-sulfanylpropan-2-ylsulfanyl)propyl]sulfanyl-5,5-dimethylhexan-2-ol (CID 87875026) is 1-[3-hydroxy-3-(2-sulfanylpropan-2-ylsulfanyl)propyl]sulfanyl-5,5-dimethylhexan-2-ol.
What is the SMILES notation for 1-[3-hydroxy-3-(2-sulfanylpropan-2-ylsulfanyl)propyl]sulfanyl-5,5-dimethylhexan-2-ol?
The canonical SMILES for 1-[3-hydroxy-3-(2-sulfanylpropan-2-ylsulfanyl)propyl]sulfanyl-5,5-dimethylhexan-2-ol is CC(C)(C)CCC(O)CSCCC(O)SC(C)(C)S.
What is the InChIKey of 1-[3-hydroxy-3-(2-sulfanylpropan-2-ylsulfanyl)propyl]sulfanyl-5,5-dimethylhexan-2-ol?
The InChIKey is UMGRZOFSYSQLND-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30O2S3/c1-13(2,3)8-6-11(15)10-18-9-7-12(16)19-14(4,5)17/h11-12,15-17H,6-10H2,1-5H3.
What are the key properties of 1-[3-hydroxy-3-(2-sulfanylpropan-2-ylsulfanyl)propyl]sulfanyl-5,5-dimethylhexan-2-ol?
1-[3-hydroxy-3-(2-sulfanylpropan-2-ylsulfanyl)propyl]sulfanyl-5,5-dimethylhexan-2-ol has a molecular weight of 326.59 g/mol, XLogP of 4.01, 9 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-hydroxy-3-(2-sulfanylpropan-2-ylsulfanyl)propyl]sulfanyl-5,5-dimethylhexan-2-ol is sourced from PubChem (CID 87875026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).