C25H34N2Ni — CID 87875058
2-N-(4-decylphenyl)-1-N-phenylpropane-1,2-diimine;nickel (PubChem CID 87875058) has the molecular formula C25H34N2Ni and a molecular weight of 421.25 g/mol. Its IUPAC name is 2-N-(4-decylphenyl)-1-N-phenylpropane-1,2-diimine;nickel.
| Compound Name | 2-N-(4-decylphenyl)-1-N-phenylpropane-1,2-diimine;nickel |
|---|---|
| PubChem CID | 87875058 |
| Molecular Formula | C25H34N2Ni |
| Molecular Weight | 421.25 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 2-N-(4-decylphenyl)-1-N-phenylpropane-1,2-diimine;nickel |
| SMILES | CCCCCCCCCCc1ccc(/N=C(C)/C=N/c2ccccc2)cc1.[Ni] |
| InChI | InChI=1S/C25H34N2.Ni/c1-3-4-5-6-7-8-9-11-14-23-17-19-25(20-18-23)27-22(2)21-26-24-15-12-10-13-16-24;/h10,12-13,15-21H,3-9,11,14H2,1-2H3;/b26-21+,27-22+; |
| InChIKey | WKDMHHRHXAGGJP-OZPLOXNPSA-N |
| XLogP | 7.86 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.25 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|