About 2-N,3-N-bis(3-ethylphenyl)heptane-2,3-diimine;palladium
2-N,3-N-bis(3-ethylphenyl)heptane-2,3-diimine;palladium (PubChem CID 87875173) has the molecular formula C23H30N2Pd
and a molecular weight of 440.93 g/mol. Its IUPAC name is 2-N,3-N-bis(3-ethylphenyl)heptane-2,3-diimine;palladium.
Molecular Properties
| Compound Name | 2-N,3-N-bis(3-ethylphenyl)heptane-2,3-diimine;palladium |
| PubChem CID | 87875173 |
| Molecular Formula | C23H30N2Pd |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 2-N,3-N-bis(3-ethylphenyl)heptane-2,3-diimine;palladium |
| SMILES | CCCCC(=N\c1cccc(CC)c1)/C(C)=N/c1cccc(CC)c1.[Pd] |
| InChI | InChI=1S/C23H30N2.Pd/c1-5-8-15-23(25-22-14-10-12-20(7-3)17-22)18(4)24-21-13-9-11-19(6-2)16-21;/h9-14,16-17H,5-8,15H2,1-4H3;/b24-18+,25-23+; |
| InChIKey | CADVSQFOQUJUAH-RYCGKRNDSA-N |
| XLogP | 6.86 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-N,3-N-bis(3-ethylphenyl)heptane-2,3-diimine;palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,3-N-bis(3-ethylphenyl)heptane-2,3-diimine;palladium?
The IUPAC name of 2-N,3-N-bis(3-ethylphenyl)heptane-2,3-diimine;palladium (CID 87875173) is 2-N,3-N-bis(3-ethylphenyl)heptane-2,3-diimine;palladium.
What is the SMILES notation for 2-N,3-N-bis(3-ethylphenyl)heptane-2,3-diimine;palladium?
The canonical SMILES for 2-N,3-N-bis(3-ethylphenyl)heptane-2,3-diimine;palladium is CCCCC(=N\c1cccc(CC)c1)/C(C)=N/c1cccc(CC)c1.[Pd].
What is the InChIKey of 2-N,3-N-bis(3-ethylphenyl)heptane-2,3-diimine;palladium?
The InChIKey is CADVSQFOQUJUAH-RYCGKRNDSA-N. The full InChI is InChI=1S/C23H30N2.Pd/c1-5-8-15-23(25-22-14-10-12-20(7-3)17-22)18(4)24-21-13-9-11-19(6-2)16-21;/h9-14,16-17H,5-8,15H2,1-4H3;/b24-18+,25-23+;.
What are the key properties of 2-N,3-N-bis(3-ethylphenyl)heptane-2,3-diimine;palladium?
2-N,3-N-bis(3-ethylphenyl)heptane-2,3-diimine;palladium has a molecular weight of 440.93 g/mol, XLogP of 6.86, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,3-N-bis(3-ethylphenyl)heptane-2,3-diimine;palladium is sourced from PubChem (CID 87875173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).