C44H64N2Ni — CID 87875299
1-N,2-N-bis(2-tridec-4-ynylphenyl)hexane-1,2-diimine;nickel (PubChem CID 87875299) has the molecular formula C44H64N2Ni and a molecular weight of 679.70 g/mol. Its IUPAC name is 1-N,2-N-bis(2-tridec-4-ynylphenyl)hexane-1,2-diimine;nickel.
| Compound Name | 1-N,2-N-bis(2-tridec-4-ynylphenyl)hexane-1,2-diimine;nickel |
|---|---|
| PubChem CID | 87875299 |
| Molecular Formula | C44H64N2Ni |
| Molecular Weight | 679.70 g/mol |
| Exact Mass | 678.44 |
| IUPAC Name | 1-N,2-N-bis(2-tridec-4-ynylphenyl)hexane-1,2-diimine;nickel |
| SMILES | CCCCCCCCC#CCCCc1ccccc1/N=C/C(CCCC)=N/c1ccccc1CCCC#CCCCCCCCC.[Ni] |
| InChI | InChI=1S/C44H64N2.Ni/c1-4-7-10-12-14-16-18-20-22-24-26-32-40-34-28-30-37-43(40)45-39-42(36-9-6-3)46-44-38-31-29-35-41(44)33-27-25-23-21-19-17-15-13-11-8-5-2;/h28-31,34-35,37-39H,4-19,24-27,32-33,36H2,1-3H3;/b45-39+,46-42+; |
| InChIKey | PLEQGDUEVRALBF-JBZLTOJGSA-N |
| XLogP | 13.50 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.70 |
| LogP ≤ 5 | 13.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|