C35H32O11S — CID 87876063
[(2R,3R,4S,5S,6S)-4,5-dibenzoyloxy-6-methoxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] benzoate (PubChem CID 87876063) has the molecular formula C35H32O11S and a molecular weight of 660.70 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-4,5-dibenzoyloxy-6-methoxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] benzoate.
| Compound Name | [(2R,3R,4S,5S,6S)-4,5-dibenzoyloxy-6-methoxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 87876063 |
| Molecular Formula | C35H32O11S |
| Molecular Weight | 660.70 g/mol |
| Exact Mass | 660.17 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-4,5-dibenzoyloxy-6-methoxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] benzoate |
| SMILES | CO[C@H]1O[C@H](COS(=O)(=O)c2ccc(C)cc2)[C@@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C35H32O11S/c1-23-18-20-27(21-19-23)47(39,40)42-22-28-29(44-32(36)24-12-6-3-7-13-24)30(45-33(37)25-14-8-4-9-15-25)31(35(41-2)43-28)46-34(38)26-16-10-5-11-17-26/h3-21,28-31,35H,22H2,1-2H3/t28-,29-,30+,31+,35+/m1/s1 |
| InChIKey | MOUJDHOVWOQOMG-PGZPJYDJSA-N |
| XLogP | 4.75 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.70 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|