About Aminosilane 3-aminopropyltrimethoxysilane
Aminosilane 3-aminopropyltrimethoxysilane (PubChem CID 87876075) has the molecular formula C6H19N2O3Si2
and a molecular weight of 223.40 g/mol.
Molecular Properties
| Compound Name | Aminosilane 3-aminopropyltrimethoxysilane |
| PubChem CID | 87876075 |
| Molecular Formula | C6H19N2O3Si2 |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | — |
| SMILES | CO[Si](CCCN)(OC)OC.N[Si] |
| InChI | InChI=1S/C6H17NO3Si.H2NSi/c1-8-11(9-2,10-3)6-4-5-7;1-2/h4-7H2,1-3H3;1H2 |
| InChIKey | HPGRRRWUPYWKMI-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Aminosilane 3-aminopropyltrimethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Aminosilane 3-aminopropyltrimethoxysilane?
The IUPAC name of Aminosilane 3-aminopropyltrimethoxysilane (CID 87876075) is not available.
What is the SMILES notation for Aminosilane 3-aminopropyltrimethoxysilane?
The canonical SMILES for Aminosilane 3-aminopropyltrimethoxysilane is CO[Si](CCCN)(OC)OC.N[Si].
What is the InChIKey of Aminosilane 3-aminopropyltrimethoxysilane?
The InChIKey is HPGRRRWUPYWKMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H17NO3Si.H2NSi/c1-8-11(9-2,10-3)6-4-5-7;1-2/h4-7H2,1-3H3;1H2.
What are the key properties of Aminosilane 3-aminopropyltrimethoxysilane?
Aminosilane 3-aminopropyltrimethoxysilane has a molecular weight of 223.40 g/mol, XLogP of -0.76, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Aminosilane 3-aminopropyltrimethoxysilane is sourced from PubChem (CID 87876075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).