C32H44N2O14P2S — CID 87877160
benzhydryl 6-[3,3-bis[bis(ethylperoxy)phosphoryl]propanoylamino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 87877160) has the molecular formula C32H44N2O14P2S and a molecular weight of 774.72 g/mol. Its IUPAC name is benzhydryl 6-[3,3-bis[bis(ethylperoxy)phosphoryl]propanoylamino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzhydryl 6-[3,3-bis[bis(ethylperoxy)phosphoryl]propanoylamino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 87877160 |
| Molecular Formula | C32H44N2O14P2S |
| Molecular Weight | 774.72 g/mol |
| Exact Mass | 774.20 |
| IUPAC Name | benzhydryl 6-[3,3-bis[bis(ethylperoxy)phosphoryl]propanoylamino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CCOOP(=O)(OOCC)C(CC(=O)NC1C(=O)N2C1SC(C)(C)C2C(=O)OC(c1ccccc1)c1ccccc1)P(=O)(OOCC)OOCC |
| InChI | InChI=1S/C32H44N2O14P2S/c1-7-40-45-49(38,46-41-8-2)25(50(39,47-42-9-3)48-43-10-4)21-24(35)33-26-29(36)34-28(32(5,6)51-30(26)34)31(37)44-27(22-17-13-11-14-18-22)23-19-15-12-16-20-23/h11-20,25-28,30H,7-10,21H2,1-6H3,(H,33,35) |
| InChIKey | JKCXFQUKSCPJLC-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 183.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.72 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|